| salts of bromoxynil with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
0 |
8 |
| salts of glyphosate, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
0 |
1 |
| salts of ioxynil with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
2 |
10 |
| salts of oxalic acid with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
1 |
2 |
| salts of thiocyanic acid, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
0 |
4 |
| selenium compounds with the exception of cadmium sulphoselenide and those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
3190 |
15 |
| Silver Compounds |
|
|
|
|
1 |
1 |
| Sodium perborate, perboric acid, sodium salt |
incomplete |
|
|
|
8 |
4 |
| Soots, tars, and mineral oils (untreated and mildly treated oils and used engine oils) |
incomplete |
|
This group has not been assigned a structural definition yet. |
|
0 |
7 |
| Sulfur containing perfluorocarbons with no unsaturations and with sulfur bonds only to carbon and fluorine |
incomplete |
|
This group hasn't been assigned a structural definition yet. |
|
0 |
14 |
| sunscreens |
|
|
|
|
9 |
0 |
| Synthetic mineral fiber (except for RCF) |
|
|
|
|
2 |
4 |
| Tellurium compounds |
incomplete |
|
This compound group has not yet been populated. |
|
1 |
2 |
| Tetrabutyltin compounds |
in progress |
|
This compound group is defined by the SMILES string '[CH3][CH2][CH2][CH2][Sn]([CH2][CH2][CH2][CH3])([CH2][CH2][CH2][CH3])[CH2][CH2][CH2][CH3]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
|
2 |
17 |
| tetrachloroplatinates with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
0 |
6 |
| Tetraoctyltin compounds |
complete |
|
This compound group is defined by the SMILES string '[CH3][CH2][CH2][CH2][CH2][CH2][CH2][CH2][Sn]([CH2][CH2][CH2][CH2][CH2][CH2][CH2][CH3])([CH2][CH2][CH2][CH2][CH2][CH2][CH2][CH3])[CH2][CH2][CH2][CH2][CH2][CH2][CH2][CH3]', then subtracting compounds with 2+ octyl ligands. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
|
0 |
15 |
| thallium compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
6 |
7 |
| Thioglycolic acid and its salts |
|
|
CASRN taken from https://ntp.niehs.nih.gov/ntp/htdocs/chem_background/exsumpdf/sodiumthioglycolate_508.pdf |
|
4 |
1 |
| thioglycolic acid esters |
|
|
CASRN taken from https://ntp.niehs.nih.gov/ntp/htdocs/chem_background/exsumpdf/sodiumthioglycolate_508.pdf |
|
1 |
0 |
| Toxins derived from Fusarium moniliforme (Fusarium verticillioides) |
incomplete |
|
This group has not been assigned a structural definition yet. |
|
0 |
3 |
| trialkylamines, trialkanolamines and their salts |
|
|
|
|
6 |
0 |
| triethyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
0 |
19 |
| trioctyltin compounds, with the exception of those specified elsewhere in this Annex |
incomplete |
|
This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
|
119 |
48 |
| tris(branched and linear 4-nonylphenyl) phosphite [with ≥ 0.1% w/w of branched and linear 4-nonylphenol] |
complete |
02/27/23 |
ECHA chemical group parent |
|
0 |
6 |
| Vanadium and compounds, unless water solubility < 4 g Vanadium/l |
complete |
|
|
|
5 |
1 |
| Vanadium Compounds |
|
|
|
|
253 |
1 |
| water soluble zinc salts |
|
|
|
|
7 |
0 |
| Zirconia Aluminosilicate Refractory Ceramic Fibres |
|
|
Zirconia Aluminosilicate Refractory Ceramic Fibres are fibres covered by index number 650-017-00-8 in Annex VI, part 3, table 3.1 of Regulation (EC) No 1272/2008 of the European Parliament and of the Council of 16 December 2008 on classification, labelling and packaging of substances and mixtures, and fulfil the three following conditions: a) oxides of aluminium, silicon and zirconium are the main components present (in the fibres) within variable concentration ranges b) fibres have a length weighted geometric mean diameter less two standard geometric errors of 6 or less micrometres (µm). c) alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+MgO+BaO) content less or equal to 18% by weight. ECHA chemical group parent |
|
1 |
18 |
| Zirconium Compounds |
in progress |
|
This compound group is defined by the SMILES string '[Zr]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
|
11 |
3 |