COMPOUND GROUP NAME | POPULATION STATUS | DATE POPULATED | DESCRIPTION | PROFILE TYPE | # MEMBERS | # HAZARDS |
---|---|---|---|---|---|---|
Octylphenol ethoxylates and related compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 125 | 5 | |
Octylphenols | incomplete | This compound group has not yet been assigned a structural definition. | other | 30 | 7 | |
Octyltin compounds | in progress | This compound group is populated by its subgroups. |
other | 138 | 14 | |
Organic compounds of mercury with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 776 | 50 | |
Organotin Compounds (OSPAR group) | incomplete | The group of organic tin compounds identified by OSPAR for priority action comprises mono-, di-, tri and tetrabutyl and triphenyl tin compounds. https://www.ospar.org/documents?v=7271 |
other | 220 | 14 | |
Palygorskite fibers (> 5µm in length) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 2 | 3 | |
Parabens | incomplete | This compound group has not yet been assigned a structural definition. | other | 11 | 3 | |
Paraffin oils (petroleum) | incomplete | This compound group has not yet been assigned a structural definition. | other | 16 | 0 | |
Paraffin waxes (coal) | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 0 | |
Paraquat, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 9 | |
Particulate matter (≤10 microns) | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
Pentane isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 1 | |
Per and Polyfluorinated Alkyl Substances (PFAS) / Perfluorinated Compounds (PFCs) | incomplete | This group is populated by:
|
other | 10774 | 12 | |
Perboric acid (H3BO2(O2)), and other sodium salts | incomplete | This compound group is defined by the SMILES string '[Na+].[O-]OB=O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 32 | 0 | |
PERFLUORINATED ALKYL SUBSTANCES (PFAS), LONG-CHAIN | incomplete | This compound group has not yet been assigned a structural definition. |
other | 192 | 17 | |
PERFLUORINATED ALKYL SUBSTANCES (PFAS), SHORT-CHAIN | incomplete | This compound group has not yet been assigned a structural definition. |
other | 4 | 15 | |
Perfluorobutanoic acid and its salts and precursors | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 0 | |
PERFLUOROCARBONS, SHORT-CHAIN | incomplete | This compound group has not yet been assigned a structural definition. | other | 6 | 13 | |
Perfluorocarboxylic Acids (PFCAs), Long-Chain (C9-C20), their Salts, and their Precursors | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
Perfluorohexane sulfonic acid (PFHxS), its salts and PFHxS-related compounds | incomplete | This compound group has not yet been assigned a structural definition. |
other | 38 | 15 | |
Perfluorooctane sulfonamides | incomplete | This compound group has not yet been assigned a structural definition. |
other | 5 | 1 | |
Perfluorooctane sulfonates C8F17SO2X (X = OH, Metal salt, halide, amide, and other derivatives including polymers) (PFOS), all members | incomplete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 19 | 12 | |
Perfluorooctanoic Acid (PFOA) Salts, and Its Precursors | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 10 | |
perfluorooctanoic acid (PFOA), its salts and PFOA-related substances | incomplete | other | 79 | 9 | ||
Perfluorooctanoic acid inorganic salts | incomplete | This compound group is defined by the SMILES string 'C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 0 | 2 | |
Perfluorooctyl silanes | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 0 | |
Persulfate salts | incomplete | This compound group is defined by the SMILES string '[O-]S(=O)(=O)OOS(=O)(=O)[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. Persulfate salts populated per SIDS Initial Assessment Report For SIAM 20 http://www.chem.unep.ch/irptc/sids/oecdsids/Persulfates.pdf |
other | 4 | 3 | |
Petrolatum (petroleum), treated and untreated | incomplete | This compound group has not yet been assigned a structural definition. | other | 34 | 0 | |
Petroleum distillates | incomplete | This compound group has not yet been assigned a structural definition. | other | 118 | 2 | |
Petroleum products | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 2 | |
Petroleum, Crude oil | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
PFNA, Perfluorononan-1-oic-acid and its salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 3 | 4 | |
PFNA, Perfluorononan-1-oic-acid and its sodium and ammonium salts | complete | 02/27/23 | other | 3 | 5 | |
Phenylenediamine compounds | incomplete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 16 | 0 | |
PHENYLHYDRAZINE SALTS | in progress | This compound group is defined by the SMILES string 'C1=CC=C(C=C1)NN'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 4 | 6 | |
Piperazine salts | incomplete | This compound group is defined by the SMILES string 'C1CNCCN1'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 3534 | 0 | |
Piproctanyl salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 3 | |
POLYBROMINATED BIPHENYLS (PBBs) | complete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 56 | 45 | |
Polybrominated dibenzodioxins | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 1 | |
Polybrominated dibenzofurans | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
POLYBROMINATED DIPHENYL ETHERS (PBDE) | incomplete | This compound group has not yet been assigned a structural definition. | other | 42 | 35 | |
Polybrominated terphenyls (PBT) | incomplete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 7 | 1 | |
POLYCHLORINATED ALKANES | incomplete | This compound group has not yet been assigned a structural definition. | other | 68 | 12 | |
POLYCHLORINATED BIPHENYLS (PCBs) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 240 | 36 | |
POLYCHLORINATED DIBENZO-P-DIOXINS (PCDD) | incomplete | This compound group has not yet been assigned a structural definition. | other | 8 | 27 | |
POLYCHLORINATED DIBENZOFURANS (PCDF) | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 20 | |
POLYCHLORINATED NAPHTHALENES (PCN) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 20 | 19 | |
Polychlorinated terphenyls (PCTs) | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 5 | |
POLYCYCLIC AROMATIC COMPOUNDS - Compound Group | incomplete | This compound group has not yet been assigned a structural definition. | other | 102 | 6 | |
POLYCYCLIC AROMATIC HYDROCARBONS (PAHs) | complete | This list is drawn from:
|
other | 95 | 19 | |
polyethlyenepolyamines with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 0 | 7 | |
Potassium Titanates | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 1 | |
Propanedinitrile, (and related derivatives) | incomplete | This compound group has not yet been assigned a structural definition. | other | 141 | 0 | |
Propanenitrile, (and related derivatives) | incomplete | This compound group has not yet been assigned a structural definition. | other | 322 | 0 | |
PROPYLENE GLYCOL & GLYCOL ETHERS (PGES) | incomplete | This compound group is defined by the SMILES string 'C(COCCO)O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 28 | 0 | |
PVC related polymers | incomplete | This compound group has not yet been assigned a structural definition. | other | 134 | 2 | |
Pyrethrins | incomplete | This compound group has not yet been assigned a structural definition. | other | 9 | 2 | |
pyrethrins including cinerins | incomplete | This compound group has not yet been assigned a structural definition. |
other | 4 | 0 | |
Pyrethroids | incomplete | This compound group has not yet been assigned a structural definition. | other | 32 | 3 | |
Pyrolysis products of organic materials with high levels of PAHs | incomplete | This list is populated from the 2018 MAK document, where listings for specific chemicals were not available: "Many of the PAH which occur regularly in pyrolysis products are carcinogenic in animal studies. They are present at particularly high levels in brown coal tars (soft coal tars), coal tars (black coal tars), coal tar pitches, coal tar oils, coke oven emissions." |
other | 15 | 0 | |
QUATERNARY AMMONIUM COMPOUNDS | complete | 07/09/19 | This compound group was populated from a manual search of the Pharos database. |
other | 120 | 1 |
Raffinates (petroleum), and various treated and processed fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 0 | |
Refractory Ceramic Fibers (with alkaline oxide and alkali earth oxide content less or equal to 18 % by weight) | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 8 | |
Refractory Ceramic Fibres with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008, [with alkaline oxide and alkali earth oxide content less or equal to 18 % by weight] | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 13 | |
Residual oils (petroleum), treated | incomplete | This compound group has not yet been assigned a structural definition. | other | 13 | 0 | |
Residues (coal tar) | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 1 | |
Residues (petroleum) and similar products | incomplete | This compound group has not yet been assigned a structural definition. | other | 58 | 0 | |
Resin acids and Rosin acids, salts and hydrogenated esters | incomplete | This compound group has not yet been assigned a structural definition. | other | 4 | 0 | |
Rhodium compounds, inorganic | in progress | This compound group is defined by the SMILES string '[Rh]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 0 | 1 | |
Salinomycin, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 1 | |
salts and esters of dinex | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
salts and esters of dinosam | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
salts and esters of dinoseb, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 2 | 12 | |
Salts and esters of dinoseb, with the exception of those specified elsewhere in Annex XVII of Regulation (EC) No 1907/2006 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 2 | 4 | |
salts and esters of MCPA | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
salts and esters of MCPB | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 1 | |
salts of 4,4'-carbonimidoylbis[N,N-dimethylaniline] | complete | The IARC monograph Auramine and Auramine Production in volume 99 lists the following commercially relevant salts: sulfate, nitrate, nitrite, acetates, propionates, bromides, iodides, salts of alkyl-, aralkyl-, or arylsulfonic acids, thiocyanates, and phosphates. CASRN were found for sulfate, nitrate and acetate. https://monographs.iarc.fr/wp-content/uploads/2018/06/mono99-9.pdf |
other | 4 | 6 | |
salts of aconitine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
salts of atropine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
salts of dichlorprop | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
salts of glyphosate | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 0 | |
Salts of hydrogen cyanide with the exception of complex cyanides and those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group has not yet been assigned a structural definition. Complex cyanides include ferrocyanides, ferricyanides and mercuric oxycyanide. Omitted chemicals (those specified in Annex VI) include
|
other | 10 | 13 | |
salts of hyoscine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 4 | |
salts of hyoscyamine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
salts of oxalic acid | incomplete | This compound group has not yet been assigned a structural definition. |
other | 2 | 0 | |
salts of physostigmine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 2 | |
salts of picric acid | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 4 | |
salts of pilocarpine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
Selenium compounds, inorganic | in progress | This compound group is defined by the SMILES string '[Se]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 0 | 2 | |
Sepiolite compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 1 | |
Short-Chain Chlorinated Paraffins (SCCP) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 3 | 18 | |
SILANE & SILOXANES GROUP | incomplete | This compound group has not yet been assigned a structural definition. | other | 48 | 0 | |
Silanes | incomplete | This compound group has not yet been assigned a structural definition. | other | 27 | 0 | |
Slack wax (petroleum), treated Slack wax | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 0 | |
Solvent naphtha (coal), and related compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 0 | |
Solvent naphtha (petroleum), and related processed products | incomplete | This compound group has not yet been assigned a structural definition. | other | 15 | 0 | |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy- (eosin and related compounds) | incomplete | This compound group has not yet been assigned a structural definition. | other | 12 | 0 | |
Strong Inorganic Acid Mists Containing Sulfuric Acid | incomplete | This group has not been assigned a structural definition yet. |
other | 0 | 1 | |
Styrene and derivatives | incomplete | This compound group has not yet been assigned a structural definition. | other | 26 | 0 | |
Tail gas (petroleum), processed, distillates and fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 31 | 0 |