COMPOUND GROUP NAME | POPULATION STATUS | DATE POPULATED | DESCRIPTION | PROFILE TYPE | # MEMBERS | # HAZARDS |
---|---|---|---|---|---|---|
Butopiprine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Butyl phenols | incomplete | Populated from Swedish EPA http://webapps.kemi.se/flodesanalyser/ |
other | 62 | 4 | |
Butylbenzyl phthalate and metabolite | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 0 | |
Cadmium Compounds, Soluble | incomplete | This compound group is populated from Table 1-1 of NTP Report on Carcinogens 1997 Background Document for Cadmium at https://ntp.niehs.nih.gov/ntp/newhomeroc/other_background/cadmium_508.pdf. |
other | 10 | 49 | |
cadmium compounds, with the exception of cadmium sulphoselenide, reaction of cadmium sulphide with zinc sulphide, reaction of cadmium sulphide with mercury sulphide, and those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals listed. |
369 | 53 | ||
Caramiphen and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Carboxylic acids (higher fatty acids) barium salts | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 1 | |
Cartap, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 4 | |
CCRIS 33 and 28 | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 1 | |
cellulases with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
0 | 1 | ||
Cephaeline and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Certain Phthalates (OSPAR) | incomplete | DBP and DEHP were added to the OSPAR List of Chemicals for Priority Action in 1998 as part of the group “certain phthalates”. https://www.ospar.org/documents?v=7028 |
fixed list | 12 | 13 | |
Chloramine T and related compounds, Tosylchloramide sodium (INN) | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Chlordimeform, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 4 | |
Chloric acid, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 3 | |
Chlorinated Alkanes (C10-20, Environment Canada) aka Chlorinated Paraffins | incomplete | This compound group is chlorinated alkanes that have the molecular formula CnHxCl(2n+2–x) in which 10 ≤ n ≤ 20 (definition used by Environment Canada). |
other | 36 | 11 | |
Chlorinated biphenyl oxides | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 7 | |
Chlorinated Flame Retardants (CFRs) | incomplete | This compound group has not yet been assigned a structural definition. |
functional use | 74 | 14 | |
Chlorinated Organic Compounds | incomplete | This compound group is defined by the SMILES string 'C[Cl]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 3970 | 6 | |
CHLORINATED PARAFFINS | incomplete | This compound group has not yet been assigned a structural definition. | other | 121 | 10 | |
CHLORINATED POLYMERS | incomplete | This compound group has not yet been assigned a structural definition. | other | 119 | 7 | |
Chlormethine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Chloroalkyl ethers | incomplete | This compound group has not yet been assigned a structural definition. | other | 4 | 0 | |
Chlorobenzenes (1-6 Chlorines) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 22 | 6 | |
Chlorobiphenyls that have the molecular formula C12H(10-n)Cln in which "n" is greater than 2 | incomplete | This group is populated by taking the POLYCHLORINATED BIPHENYLS (PCBs) group and removing members with 2 chlorine atoms. |
223 | 37 | ||
Chloroethanes | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 2 | |
CHLOROFLUOROCARBONS (CFC) | incomplete | This compound group has not yet been assigned a structural definition. A structural search would require eliminating compounds containing carbon-hydrogen bonds, which is challenging. |
other | 45 | 4 | |
chloronitroanilines | incomplete | This compound group has not yet been assigned a structural definition. |
structure | 1 | 0 | |
chloronitroanilines with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
0 | 6 | ||
CHLOROPHENOLS | incomplete | This compound group has not yet been assigned a structural definition. | other | 33 | 3 | |
Chloroplatinates | incomplete | This compound group has not yet been assigned a structural definition. |
structure | 5 | 1 | |
Chlorprothixene and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Choline salts and their esters | incomplete | This compound group has not yet been assigned a structural definition. | structure | 2 | 1 | |
Chromic acid, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 6 | 5 | |
Chromium (VI) compounds, with the exception of barium chromate and of compounds specified elsewhere in Annex VI to Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
118 | 51 | ||
Chromium Compounds | incomplete | This compound group is defined by the SMILES string '[Cr]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
element | 535 | 4 | |
Cinchocaine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Cinchophen, its salts, derivatives and salts of these derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 2 | 1 | |
Clarified oils (petroleum), Heavy Fuel oils | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 0 | |
Coal distillates | incomplete | This compound group has not yet been assigned a structural definition. | other | 6 | 0 | |
Coal liquids, liquid solvent extraction and solution | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 0 | |
Coal tar distillates | incomplete | This compound group has not yet been assigned a structural definition. | other | 25 | 1 | |
Coal tar pitch volatiles (coal tar products) | incomplete | This group has not been assigned a structural definition yet. |
0 | 3 | ||
Coal tars, coal tar pitches, coal tar oils | incomplete | This compound group has not yet been assigned a structural definition. |
other | 12 | 5 | |
Cobalt nickel compounds | incomplete | This compound group has not yet been assigned a structural definition. | structure | 4 | 0 | |
Cobalt sulfate heptahydrate (and other soluble cobalt(II) salts) | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
Cobalt-Tungsten Carbide Powders and Hard Metals | incomplete | This compound group has not yet been assigned a structural definition. |
0 | 2 | ||
Colchicine, its salts and derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Colchicoside and its derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Colouring agent CI 12075 | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Compounds Potentially Degrading to PFOS | incomplete | List extracted from Annex 1 of Dossier prepared in support for a nomination of PFOS to the UN-ECE LRTAP Protocol and the Stockholm Convention The dossier is prepared by the Swedish Chemicals Inspectorate (KemI) and the Swedish EPA, Sweden August 2004 |
fixed list | 106 | 15 | |
Conjugated estrogens | incomplete | This group has not been assigned a structural definition yet. |
0 | 5 | ||
Copper compounds | incomplete | This compound group is populated with copper metal, and a limited number of copper salts and alloys. |
element | 7 | 5 | |
CREOSOTE COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. | other | 13 | 6 | |
Creosote oil and creosote oil acenaphthene fractions and distillates | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 0 | |
Crimidine, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 1 | |
CRYSTALLINE SILICAS - RESPIRABLE | incomplete | The various forms of crystalline silica are: α-quartz, β-quartz, α-tridymite, β-tridymite, α-cristobalite, β-cristobalite, keatite, coesite, stishovite, and moganite. NIOSH (2002)....Keatite, coesite, stishovite, and moganite are rarely found in nature. The most commonly occurring polymorphs are quartz, cristobalite and tridymite, which are found in rocks and soil. NIOSH Hazard Review: Health Effects of Occupational Exposure to Respirable Crystalline Silica (DHHS (NIOSH) Publication No. 2002–129). Cincinnati, OH, 145 pp. |
other | 9 | 8 | |
Cyclic, branched or linear completely fluorinated alkanes | incomplete | This group hasn't been assigned a structural definition yet. |
0 | 14 | ||
Cyclic, branched or linear completely fluorinated tertiary amines with no unsaturations | incomplete | This group hasn't been assigned a structural definition yet. |
0 | 14 | ||
Cyclic, branched, or linear completely fluorinated ethers with no unsaturations | incomplete | This group hasn't been assigned a structural definition yet. |
0 | 14 | ||
Cyclizine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Cyclohexane-1,2-dicarboxylic anhydrides | incomplete | This compound group is defined by the SMILES string 'C1CCC2C(C1)C(=O)OC2=O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. ECHA chemical group parent: all possible combinations of the cis- and trans-isomers |
other | 3 | 4 | |
Cyclomenol and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Cyclophosphamide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Decamethonium bromide | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Dextromethorphan and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Diazonium salts | incomplete | This compound group is defined by the SMILES string 'C=[N+]=[N-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 603 | 2 | |
Dibenzanthracenes | incomplete | This group has not been assigned a structural definition yet. |
0 | 4 | ||
Dicresyl phosphates - Biomonitoring CA | incomplete | This group is populated from the list at https://biomonitoring.ca.gov/chemicals |
fixed list | 0 | 1 | |
Diethyl phthalate and metabolite | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 0 | |
Diglycidyl ethers of p,p´-bisphenols - Biomonitoring CA | incomplete | This group is populated from the list at https://biomonitoring.ca.gov/chemicals |
fixed list | 0 | 2 | |
Diisobutyl phthalate and metabolite | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 0 | |
Diisocyanates | incomplete | 03/26/21 | This compound group is from the C2C V4 RSL. |
25 | 6 | |
Diisononyl phthalate (DINP) compounds | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 16 | |
Dimethyl phthalate and metabolite | incomplete | This compound group has not yet been assigned a structural definition. | other | 4 | 0 | |
Dimethylphenols | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 0 | |
Dimevamide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Dinitro-ortho-cresol (DNOC) salts | incomplete | This compound group is defined by the SMILES string 'CC1=C(C=C(C=C1O)[N+](=O)[O-])[N+](=O)[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | 3 | 1 | ||
Dinitrobenzene isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 8 | 1 | |
Dinitronaphthalene isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
Dinitrophenols | incomplete | This compound group has not yet been assigned a structural definition. | other | 9 | 1 | |
Dinitrotoluenes | incomplete | This compound group has not yet been assigned a structural definition. | other | 15 | 1 | |
Dinoseb salts and esters | incomplete | This compound group is defined by the SMILES string 'CCC(C)C1=CC(=CC(=C1O)[N+](=O)[O-])[N+](=O)[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 10 | 1 | |
Dioxethedrin and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
DIOXINS & DIOXIN-LIKE COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. |
other | 22 | 13 | |
Diphenhydramine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Diphenylpyraline and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Dithiocarbamates | incomplete | This compound group is defined by the SMARTS string 'C(=[SD1])([ND1])[SD1]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 0 | 1 | |
Dodecyl phenols | incomplete | Populated from Swedish EPA http://webapps.kemi.se/flodesanalyser/ |
other | 8 | 4 | |
Doxylamine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Emetine, its salts and derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Erionite | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 0 | |
Eserine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
esters of 2,4-D | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
esters of mecoprop and of mecoprop-P | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
Estrogens, steroidal | incomplete | This group has not been assigned a structural definition yet. |
0 | 4 | ||
Ethanol, 2,2'-iminobis-, reaction products with epichlorohydrin and 2-nitro-1,4-benzenediamine (HC Blue No. 5) and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 2 | 1 | |
Ethoheptazine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Ethylene amines | incomplete | This compound group is defined by the SMILES string 'C(CN)N'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 12 | 1 | |
ethylenediammonium O,O-bis(octyl) phosphorodithioate, mixed isomers | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 4 |