| COMPOUND GROUP NAME | POPULATION STATUS | DATE POPULATED | DESCRIPTION | PROFILE TYPE | # MEMBERS | # HAZARDS |
|---|---|---|---|---|---|---|
| Refractory Ceramic Fibers (with alkaline oxide and alkali earth oxide content less or equal to 18 % by weight) | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 8 | |
| Refractory Ceramic Fibres with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008, [with alkaline oxide and alkali earth oxide content less or equal to 18 % by weight] | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 10 | |
| Residual oils (petroleum), treated | incomplete | This compound group has not yet been assigned a structural definition. | other | 12 | 1 | |
| Residues (coal tar) | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 2 | |
| Residues (petroleum) and similar products | incomplete | This compound group has not yet been assigned a structural definition. | other | 58 | 1 | |
| Resin acids and Rosin acids, salts and hydrogenated esters | incomplete | This compound group has not yet been assigned a structural definition. | other | 4 | 1 | |
| Rhodium compounds, inorganic | in progress | This compound group is defined by the SMILES string '[Rh]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 0 | 1 | |
| Salinomycin, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 1 | |
| salts and esters of dinex | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
| salts and esters of dinosam | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
| salts and esters of dinoseb, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 2 | 10 | |
| Salts and esters of dinoseb, with the exception of those specified elsewhere in Annex XVII of Regulation (EC) No 1907/2006 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 2 | 4 | |
| salts and esters of MCPA | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
| salts and esters of MCPB | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 1 | |
| salts of 4,4'-carbonimidoylbis[N,N-dimethylaniline] | complete | The IARC monograph Auramine and Auramine Production in volume 99 lists the following commercially relevant salts: sulfate, nitrate, nitrite, acetates, propionates, bromides, iodides, salts of alkyl-, aralkyl-, or arylsulfonic acids, thiocyanates, and phosphates. CASRN were found for sulfate, nitrate and acetate. https://monographs.iarc.fr/wp-content/uploads/2018/06/mono99-9.pdf |
other | 4 | 5 | |
| salts of 4,4'-thiodianiline | incomplete | This compound group is defined by the SMILES string '[CH1]1=[CH1]C(=[CH1][CH1]=C1[SD2]C2=[CH1][CH1]=C([CH1]=[CH1]2)[ND1])[ND1]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 0 | 2 | |
| salts of aconitine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
| salts of atropine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
| salts of dichlorprop | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
| salts of glyphosate | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 0 | |
| Salts of hydrogen cyanide with the exception of complex cyanides and those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group has not yet been assigned a structural definition. Complex cyanides include ferrocyanides, ferricyanides and mercuric oxycyanide. Omitted chemicals (those specified in Annex VI) include
|
other | 10 | 13 | |
| salts of hyoscine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 4 | |
| salts of hyoscyamine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
| salts of oxalic acid | incomplete | This compound group has not yet been assigned a structural definition. |
other | 2 | 0 | |
| salts of physostigmine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 2 | |
| salts of picric acid | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 4 | |
| salts of pilocarpine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 3 | |
| Selenium compounds, inorganic | in progress | This compound group is defined by the SMILES string '[Se]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 0 | 2 | |
| Sepiolite compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 1 | |
| Short-Chain Chlorinated Paraffins (SCCP) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 3 | 9 | |
| SILANE & SILOXANES GROUP | incomplete | This compound group has not yet been assigned a structural definition. | other | 47 | 0 | |
| Silanes | incomplete | This compound group has not yet been assigned a structural definition. | other | 27 | 0 | |
| Slack wax (petroleum), treated Slack wax | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 1 | |
| Solvent naphtha (coal), and related compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 1 | |
| Solvent naphtha (petroleum), and related processed products | incomplete | This compound group has not yet been assigned a structural definition. | other | 15 | 1 | |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy- (eosin and related compounds) | incomplete | This compound group has not yet been assigned a structural definition. | other | 11 | 1 | |
| Strong Inorganic Acid Mists Containing Sulfuric Acid | incomplete | This group has not been assigned a structural definition yet. |
other | 0 | 1 | |
| Styrene and derivatives | incomplete | This compound group has not yet been assigned a structural definition. | other | 26 | 1 | |
| Tail gas (petroleum), processed, distillates and fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 31 | 1 | |
| Tar acids, distillate phenols, crude phenols and other related fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 14 | 1 | |
| Tar bases, coal and other Distillate Bases | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 1 | |
| Tar oils, coal and oil fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 1 | |
| Tar, brown-coal | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
| Tars, coal | incomplete | This compound group has not yet been assigned a structural definition. | other | 8 | 1 | |
| Tetraalkyl lead compounds | in progress | This compound group has not yet been assigned a structural definition. One approach would be to use the SMILES string 'C[Pb](*C)(C)C' and remove substances containing 'c[Pb]' (lowercase specifies aromatic). There are technical challenges since PubChem doesn't seem to provide an option to distinguish between aromatic and aliphatic carbons. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 22 | 58 | |
| Tetrachlorobenzenes | complete | This compound group has not yet been assigned a structural definition. | other | 4 | 7 | |
| TETRACYCLINES | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
| THALLIUM (I), SOLUBLE SALTS | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 4 | |
| Thiazoles | incomplete | This compound group is defined by the SMILES string 'C1=CSC=N1'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 0 | 1 | |
| Thioglycolates | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
| Thiurams | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
| TIN COMPOUNDS, INORGANIC | in progress | This compound group is defined by the SMILES string '[Sn]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 2 | 5 | |
| Titanium dioxide compounds | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 10 | |
| Toluenediisocyanates (MAK list) | incomplete | This groups is populated from three chemicals in the MAK list. |
other | 0 | 2 | |
| Toxic Heavy Metals | incomplete | Compounds containing
|
other | 5026 | 1 | |
| Trialkyl tin hydroxide | incomplete | This compound group has not yet been assigned a structural definition. Distinguishing between alkyl and aryl side chains is not straightforward in PubChem's substructure searches. The SMILES string "[CH2][Sn]([CH2])([CH2])[OH]" captures the relevant groups but is not specific enough. |
other | 0 | 5 | |
| Trialkyltinhydroxide, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
| Trialkyltinoxide | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
| Triaryl tin hydroxide | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
| Tributyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 114 | 34 | |
| Tributyltin compounds, with the exception of those specified elsewhere in Annex XVII of Regulation (EC) No 1907/2006 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 114 | 27 | |
| Trichlorobenzenes | complete | This compound group has not yet been assigned a structural definition. | other | 4 | 6 | |
| Trichlorophenol and its salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 0 | |
| Trihalomethanes | incomplete | This compound group is defined by the SMILES string '[CH]([F,Cl,Br,I])([F,Cl,Br,I])[F,Cl,Br,I]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 4 | 1 | |
| Trimethylbenzene isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 2 | |
| Trimethylhexamethylene-1,6-di-isocyanates | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
| Trimethylpentane isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 1 | |
| Trimethyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 2 | 14 | |
| Trinickel, other salts | incomplete | This compound group has not yet been assigned a structural definition. | other | 6 | 1 | |
| Triphenyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 24 | |
| Triphenyltin fatty acid ester (alkyl C=9-11) | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 21 | |
| Tripropyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 0 | 12 | |
| Uranium compounds with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 6 | |
| Uranium compounds, insoluble | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
| Uranium compounds, soluble inorganic | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 4 | |
| Vanadium compounds, inorganic | in progress | This compound group is defined by the SMILES string '[V]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 1 | 3 | |
| Vinyl halides | complete | This compound group is composed of four chemicals so no substructure search is needed to populate it |
other | 4 | 2 | |
| Volatile esters of bromoacetic acids | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
| Volatile Methylated Siloxanes (VMS) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 8 | 2 | |
| VOLATILE ORGANIC COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 0 | |
| Warfarin, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 5 | |
| XYLENE COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. | other | 16 | 2 | |
| Xylidine isomers | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 1 | |
| Xylidines with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 6 | 6 | |
| Zinc Alloys | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 0 | |
| Zirconium, insoluble compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 4 | |
| Zirconium, soluble compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 3 |