COMPOUND GROUP NAME | POPULATION STATUS | DATE POPULATED | DESCRIPTION | PROFILE TYPE | # MEMBERS | # HAZARDS |
---|---|---|---|---|---|---|
salts of hyoscyamine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 2 | |
salts of oxalic acid | incomplete | This compound group has not yet been assigned a structural definition. |
other | 2 | 0 | |
salts of physostigmine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 2 | |
salts of picric acid | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 4 | |
salts of pilocarpine | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 2 | |
Selenium compounds, inorganic | in progress | This compound group is defined by the SMILES string '[Se]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 0 | 2 | |
Sepiolite compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 1 | |
Short-Chain Chlorinated Paraffins (SCCP) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 3 | 9 | |
SILANE & SILOXANES GROUP | incomplete | This compound group has not yet been assigned a structural definition. | other | 47 | 0 | |
Silanes | incomplete | This compound group has not yet been assigned a structural definition. | other | 27 | 0 | |
Slack wax (petroleum), treated Slack wax | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 1 | |
Solvent naphtha (coal), and related compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 1 | |
Solvent naphtha (petroleum), and related processed products | incomplete | This compound group has not yet been assigned a structural definition. | other | 15 | 1 | |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',4',5',7'-tetrabromo-3',6'-dihydroxy- (eosin and related compounds) | incomplete | This compound group has not yet been assigned a structural definition. | other | 11 | 1 | |
Strong Inorganic Acid Mists Containing Sulfuric Acid | incomplete | This group has not been assigned a structural definition yet. |
other | 0 | 1 | |
Styrene and derivatives | incomplete | This compound group has not yet been assigned a structural definition. | other | 26 | 1 | |
Tail gas (petroleum), processed, distillates and fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 31 | 1 | |
Tar acids, distillate phenols, crude phenols and other related fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 14 | 1 | |
Tar bases, coal and other Distillate Bases | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 1 | |
Tar oils, coal and oil fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 1 | |
Tar, brown-coal | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
Tars, coal | incomplete | This compound group has not yet been assigned a structural definition. | other | 8 | 1 | |
Tetraalkyl lead compounds | in progress | This compound group has not yet been assigned a structural definition. One approach would be to use the SMILES string 'C[Pb](*C)(C)C' and remove substances containing 'c[Pb]' (lowercase specifies aromatic). There are technical challenges since PubChem doesn't seem to provide an option to distinguish between aromatic and aliphatic carbons. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 22 | 57 | |
Tetrachlorobenzenes | complete | This compound group has not yet been assigned a structural definition. | other | 4 | 6 | |
TETRACYCLINES | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
THALLIUM (I), SOLUBLE SALTS | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 2 | |
Thiazoles | incomplete | This compound group is defined by the SMILES string 'C1=CSC=N1'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 0 | 1 | |
Thioglycolates | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
Thiurams | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
TIN COMPOUNDS, INORGANIC | in progress | This compound group is defined by the SMILES string '[Sn]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 2 | 5 | |
Titanium dioxide compounds | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 10 | |
Toluenediisocyanates (MAK list) | incomplete | This groups is populated from three chemicals in the MAK list. |
other | 0 | 2 | |
Toxic Heavy Metals | incomplete | Compounds containing
|
other | 5024 | 1 | |
Trialkyl tin hydroxide | incomplete | This compound group has not yet been assigned a structural definition. Distinguishing between alkyl and aryl side chains is not straightforward in PubChem's substructure searches. The SMILES string "[CH2][Sn]([CH2])([CH2])[OH]" captures the relevant groups but is not specific enough. |
other | 0 | 5 | |
Trialkyltinhydroxide, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
Trialkyltinoxide | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
Triaryl tin hydroxide | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 5 | |
Tributyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 114 | 34 | |
Tributyltin compounds, with the exception of those specified elsewhere in Annex XVII of Regulation (EC) No 1907/2006 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 114 | 27 | |
Trichlorobenzenes | complete | This compound group has not yet been assigned a structural definition. | other | 4 | 5 | |
Trichlorophenol and its salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 0 | |
Trihalomethanes | incomplete | This compound group is defined by the SMILES string '[CH]([F,Cl,Br,I])([F,Cl,Br,I])[F,Cl,Br,I]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 4 | 1 | |
Trimethylbenzene isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 2 | |
Trimethylhexamethylene-1,6-di-isocyanates | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
Trimethylpentane isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 1 | |
Trimethyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 2 | 14 | |
Trinickel, other salts | incomplete | This compound group has not yet been assigned a structural definition. | other | 6 | 1 | |
Triphenyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 24 | |
Triphenyltin fatty acid ester (alkyl C=9-11) | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 21 | |
Tripropyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 0 | 12 | |
Uranium compounds with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 6 | |
Uranium compounds, insoluble | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
Uranium compounds, soluble inorganic | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 4 | |
Vanadium compounds, inorganic | in progress | This compound group is defined by the SMILES string '[V]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 1 | 2 | |
Vinyl halides | complete | This compound group is composed of four chemicals so no substructure search is needed to populate it |
other | 4 | 2 | |
Volatile esters of bromoacetic acids | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
Volatile Methylated Siloxanes (VMS) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 8 | 2 | |
VOLATILE ORGANIC COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 0 | |
Warfarin, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 3 | |
XYLENE COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. | other | 16 | 2 | |
Xylidine isomers | incomplete | This compound group has not yet been assigned a structural definition. |
other | 8 | 0 | |
Xylidines with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 6 | 5 | |
Zinc Alloys | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 0 | |
Zirconium, insoluble compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
Zirconium, soluble compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 |