COMPOUND GROUP NAME | POPULATION STATUS | DATE POPULATED | DESCRIPTION | PROFILE TYPE | # MEMBERS | # HAZARDS |
---|---|---|---|---|---|---|
N-Alkyl toluidine, salts | incomplete | This compound group has not yet been assigned a structural definition. Because of the heterogeneity of the alkyl groups, populating this group through a structural search may not be feasible. As a starting point, the following three structures get close but do not constrain the alkyl group properly (o, m, p): [CH3]C1=C([CH1]=[CH1][CH1]=[CH1]1)[ND2][CH2] plus [CH1]1=C([CH1]=C([CH1]=[CH1]1)[CH3])[ND2][CH2] plus [CH1]1=C([CH1]=[CH1]C(=[CH1]1)[CH3])[ND2][CH2] |
other | 3 | 4 | |
Naphtha (petroleum), treated fractions, - unspecified | incomplete | This compound group has not yet been assigned a structural definition. | other | 64 | 1 | |
Naphthenic oils (petroleum), dewaxed light and heavy, Baseoil - unspecified | incomplete | This compound group has not yet been assigned a structural definition. | other | 4 | 1 | |
Natural gas (petroleum), condensates - unspecified | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 1 | |
Nickel (soluble compounds) | incomplete | other | 0 | 1 | ||
Nickel acetate similar soluble salts | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 26 | |
Nickel bis(sulfate)s | incomplete | This compound group is defined by the SMILES string '[Ni+2].[O-]S(=O)(=O)[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 2 | 1 | |
Nickel borides | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 1 | |
Nickel carbonates | incomplete | This compound group is defined by the SMILES string '[Ni+2].C(=O)([OX1-])[OX1-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 5 | 1 | |
Nickel compounds, inorganic | in progress | This compound group is defined by the SMILES string '[Ni]' subtracting '[Ni].C'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 14 | 2 | |
NICKEL COMPOUNDS, INSOLUBLE | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 25 | |
NICKEL COMPOUNDS, SOLUBLE | incomplete | This group was populated based on: http://www.osha.gov/SLTC/healthguidelines/nickelsolublecompounds/recognition.html | other | 5 | 26 | |
Nickel formates | incomplete | This compound group is defined by the SMILES string '[Ni+2].[CH1](=O)[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 3 | 1 | |
Nickel halides | incomplete | This compound group is defined by the SMILES string '[Ni+2].[F,Cl,Br,I;X0-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 4 | 1 | |
Nickel hydroxides | incomplete | This compound group is defined by the SMILES string '[Ni+2].[OX1H-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 3 | 1 | |
Nickel nitrates | incomplete | This compound group is defined by the SMILES string '[Ni+2].[N+](=O)([O-])[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 3 | 1 | |
Nickel oxalates | incomplete | This compound group is defined by the SMILES string '[Ni+2].C(=O)(C(=O)[O-])[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 2 | 1 | |
Nickel phosphates and phosphinates | incomplete | This compound group is defined by the SMILES string 'Phosphate: [O-]P(=O)([O-])[O-].[Ni+2] Phosphide...'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 7 | 1 | |
Nickel phosphides | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 1 | |
Nickel silicates | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 1 | |
Nickel silicides | incomplete | This compound group has not yet been assigned a structural definition. | other | 4 | 1 | |
Nitrilotriacetic acid sodium salts | incomplete | This compound group is defined by the SMILES string 'C(C(=O)O)N(CC(=O)O)CC(=O)O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 5 | 2 | |
Nitro PAHS | incomplete | This compound group has not yet been assigned a structural definition. | other | 9 | 1 | |
Nitrophenols | incomplete | This compound group has not yet been assigned a structural definition. | other | 8 | 1 | |
Nitropyrene compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 4 | 1 | |
Nitrosamines | incomplete | This compound group is defined by the SMILES string 'NN=O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 23 | 1 | |
nitrotoluidines, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 0 | 5 | |
Nitrous acid, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 3 | |
Non-chlorinated Phenols | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
Nonylphenol ethoxylates (NPEs) | incomplete | This compound group was populated from reports provided by the US EPA, Canadian government, and ECHA, as well as searches for 'nonylphenol' in the ECHA C&L Inventory, PubChem and the 2016 GADSL list. http://echa.europa.eu/documents/10162/f24cf2d8-11d5-4495-9e18-065b34e94e0b https://echa.europa.eu/information-on-chemicals/cl-inventory-database |
other | 308 | 28 | |
Nonylphenol, branched and linear, ethoxylated, EO =< 11 mol | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 29 | |
Nonylphenol, branched and linear, ethoxylated, EO > 11 mol | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 29 | |
Nonylphenols | incomplete | This compound group has not yet been assigned a structural definition. | other | 81 | 25 | |
Nonylphenols and Nonylphenol Ethoxylates (NPEs) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 373 | 13 | |
o-Dianisidine-based dyes | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 2 | |
o-Tolidine-based dyes | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 2 | |
Octylphenol ethoxylates | incomplete | This compound group is defined by the SMILES string 'CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCO'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 91 | 9 | |
Octylphenol ethoxylates and related compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 125 | 4 | |
Octylphenols | incomplete | This compound group has not yet been assigned a structural definition. | other | 30 | 5 | |
Octyltin compounds | in progress | This compound group is populated by its subgroups. |
other | 19 | 9 | |
Organic compounds of mercury with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 775 | 41 | |
Organotin Compounds (OSPAR group) | incomplete | The group of organic tin compounds identified by OSPAR for priority action comprises mono-, di-, tri and tetrabutyl and triphenyl tin compounds. https://www.ospar.org/documents?v=7271 |
other | 219 | 8 | |
Palygorskite fibers (> 5µm in length) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 2 | 2 | |
Parabens | incomplete | This compound group has not yet been assigned a structural definition. | other | 11 | 3 | |
Paraffin oils (petroleum) | incomplete | This compound group has not yet been assigned a structural definition. | other | 16 | 1 | |
Paraffin waxes (coal) | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 1 | |
Paraquat, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 9 | |
Particulate matter (≤10 microns) | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
Pentachlorophenol salts and esters | incomplete | This compound group is defined by the SMILES string 'C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. It was populated from the Proposal to list pentachlorophenol and its salts and esters in Annexes A, B and/or C to the Stockholm Convention on Persistent Organic Pollutants as well as the 2016 GADSL list at http://www.gadsl.org/ |
other | 13 | 5 | |
Pentane isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 1 | |
Per and Polyfluorinated Alkyl Substances (PFAS) / Perfluorinated Compounds (PFCs) | incomplete | This group is populated by:
|
other | 10709 | 9 | |
Perboric acid (H3BO2(O2)), and other sodium salts | incomplete | This compound group is defined by the SMILES string '[Na+].[O-]OB=O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 22 | 1 | |
PERFLUORINATED ALKYL SUBSTANCES (PFAS), LONG-CHAIN | incomplete | This compound group has not yet been assigned a structural definition. |
other | 145 | 15 | |
PERFLUORINATED ALKYL SUBSTANCES (PFAS), SHORT-CHAIN | incomplete | This compound group has not yet been assigned a structural definition. |
other | 4 | 13 | |
Perfluorobutanoic acid and its salts and precursors | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 0 | |
PERFLUOROCARBONS, SHORT-CHAIN | incomplete | This compound group has not yet been assigned a structural definition. | other | 6 | 10 | |
Perfluorocarboxylic Acids (PFCAs), Long-Chain (C9-C20), their Salts, and their Precursors | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 2 | |
Perfluorohexane sulfonic acid (PFHxS), its salts and PFHxS-related compounds | incomplete | This compound group has not yet been assigned a structural definition. |
other | 2 | 11 | |
Perfluorooctane sulfonamides | incomplete | This compound group has not yet been assigned a structural definition. |
other | 5 | 1 | |
Perfluorooctane sulfonates C8F17SO2X (X = OH, Metal salt, halide, amide, and other derivatives including polymers) (PFOS), all members | incomplete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 20 | 10 | |
Perfluorooctanoic Acid (PFOA) Salts, and Its Precursors | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 5 | |
perfluorooctanoic acid (PFOA), its salts and PFOA-related substances | incomplete | other | 80 | 3 | ||
Perfluorooctanoic acid inorganic salts | incomplete | This compound group is defined by the SMILES string 'C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 0 | 2 | |
Perfluorooctyl silanes | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 0 | |
Persulfate salts | incomplete | This compound group is defined by the SMILES string '[O-]S(=O)(=O)OOS(=O)(=O)[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. Persulfate salts populated per SIDS Initial Assessment Report For SIAM 20 http://www.chem.unep.ch/irptc/sids/oecdsids/Persulfates.pdf |
other | 4 | 3 | |
Petrolatum (petroleum), treated and untreated | incomplete | This compound group has not yet been assigned a structural definition. | other | 34 | 1 | |
Petroleum distillates | incomplete | This compound group has not yet been assigned a structural definition. | other | 118 | 1 | |
Petroleum products | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 1 | |
Petroleum, Crude oil | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 2 | |
PFNA, Perfluorononan-1-oic-acid and its salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 3 | 2 | |
PFNA, Perfluorononan-1-oic-acid and its sodium and ammonium salts | incomplete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 0 | 0 | |
Phenylenediamine compounds | incomplete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 16 | 0 | |
PHENYLHYDRAZINE SALTS | in progress | This compound group is defined by the SMILES string 'C1=CC=C(C=C1)NN'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 4 | 5 | |
Piperazine salts | incomplete | This compound group is defined by the SMILES string 'C1CNCCN1'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 3533 | 1 | |
Piproctanyl salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 3 | |
POLYBROMINATED BIPHENYLS (PBBs) | complete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 56 | 32 | |
Polybrominated dibenzodioxins | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 2 | |
Polybrominated dibenzofurans | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 4 | |
POLYBROMINATED DIPHENYL ETHERS (PBDE) | incomplete | This compound group has not yet been assigned a structural definition. | other | 42 | 24 | |
Polybrominated terphenyls (PBT) | incomplete | This compound group was populated from the 2016 GADSL list at http://www.gadsl.org/ |
other | 7 | 0 | |
POLYCHLORINATED ALKANES | incomplete | This compound group has not yet been assigned a structural definition. | other | 68 | 9 | |
POLYCHLORINATED BIPHENYLS (PCBs) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 240 | 33 | |
POLYCHLORINATED DIBENZO-P-DIOXINS (PCDD) | incomplete | This compound group has not yet been assigned a structural definition. | other | 8 | 22 | |
POLYCHLORINATED DIBENZOFURANS (PCDF) | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 13 | |
POLYCHLORINATED NAPHTHALENES (PCN) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 20 | 12 | |
Polychlorinated terphenyls (PCTs) | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 4 | |
POLYCYCLIC AROMATIC COMPOUNDS - Compound Group | incomplete | This compound group has not yet been assigned a structural definition. | other | 104 | 3 | |
POLYCYCLIC AROMATIC HYDROCARBONS (PAH) | complete | This list is drawn from:
|
other | 97 | 13 | |
polyethlyenepolyamines with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 0 | 6 | |
Potassium Titanates | incomplete | This compound group has not yet been assigned a structural definition. | other | 5 | 1 | |
Propanedinitrile, (and related derivatives) | incomplete | This compound group has not yet been assigned a structural definition. | other | 141 | 1 | |
Propanenitrile, (and related derivatives) | incomplete | This compound group has not yet been assigned a structural definition. | other | 320 | 1 | |
PROPYLENE GLYCOL & GLYCOL ETHERS (PGES) | incomplete | This compound group is defined by the SMILES string 'C(COCCO)O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 28 | 0 | |
PVC related polymers | incomplete | This compound group has not yet been assigned a structural definition. | other | 134 | 2 | |
Pyrethrins | incomplete | This compound group has not yet been assigned a structural definition. | other | 9 | 2 | |
pyrethrins including cinerins | incomplete | This compound group has not yet been assigned a structural definition. |
other | 4 | 0 | |
Pyrethroids | incomplete | This compound group has not yet been assigned a structural definition. | other | 22 | 2 | |
Pyrolysis products of organic materials with high levels of PAHs | incomplete | This list is populated from the 2018 MAK document, where listings for specific chemicals were not available: "Many of the PAH which occur regularly in pyrolysis products are carcinogenic in animal studies. They are present at particularly high levels in brown coal tars (soft coal tars), coal tars (black coal tars), coal tar pitches, coal tar oils, coke oven emissions." |
other | 15 | 0 | |
QUATERNARY AMMONIUM COMPOUNDS | complete | 07/09/19 | This compound group was populated from a manual search of the Pharos database. |
other | 120 | 1 |
Raffinates (petroleum), and various treated and processed fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 1 |